C9H23N7O2 — CID 158640950
tert-butyl N-[2-(diaminomethylideneamino)ethyl]carbamate;guanidine (PubChem CID 158640950) has the molecular formula C9H23N7O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is tert-butyl N-[2-(diaminomethylideneamino)ethyl]carbamate;guanidine.
| Compound Name | tert-butyl N-[2-(diaminomethylideneamino)ethyl]carbamate;guanidine |
|---|---|
| PubChem CID | 158640950 |
| Molecular Formula | C9H23N7O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | tert-butyl N-[2-(diaminomethylideneamino)ethyl]carbamate;guanidine |
| SMILES | CC(C)(C)OC(=O)NCCN=C(N)N.[H]N=C(N)N |
| InChI | InChI=1S/C8H18N4O2.CH5N3/c1-8(2,3)14-7(13)12-5-4-11-6(9)10;2-1(3)4/h4-5H2,1-3H3,(H,12,13)(H4,9,10,11);(H5,2,3,4) |
| InChIKey | IAJKBDCCJUMPFV-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|