C8H17N5O3 — CID 155381201
tert-butyl N-[2-[[amino-(2-oxohydrazinyl)methylidene]amino]ethyl]carbamate (PubChem CID 155381201) has the molecular formula C8H17N5O3 and a molecular weight of 231.26 g/mol. Its IUPAC name is tert-butyl N-[2-[[amino-(2-oxohydrazinyl)methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[amino-(2-oxohydrazinyl)methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 155381201 |
| Molecular Formula | C8H17N5O3 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl N-[2-[[amino-(2-oxohydrazinyl)methylidene]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC/N=C(\N)NN=O |
| InChI | InChI=1S/C8H17N5O3/c1-8(2,3)16-7(14)11-5-4-10-6(9)12-13-15/h4-5H2,1-3H3,(H,11,14)(H3,9,10,12,15) |
| InChIKey | WTCWSAHCHXDYBG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|