C16H26N4O2 — CID 110026726
tert-butyl N-[4-[[amino(anilino)methylidene]amino]butyl]carbamate (PubChem CID 110026726) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[4-[[amino(anilino)methylidene]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[amino(anilino)methylidene]amino]butyl]carbamate |
|---|---|
| PubChem CID | 110026726 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | tert-butyl N-[4-[[amino(anilino)methylidene]amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC/N=C(\N)Nc1ccccc1 |
| InChI | InChI=1S/C16H26N4O2/c1-16(2,3)22-15(21)19-12-8-7-11-18-14(17)20-13-9-5-4-6-10-13/h4-6,9-10H,7-8,11-12H2,1-3H3,(H,19,21)(H3,17,18,20) |
| InChIKey | PIRZXEDOQGBESM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|