C17H29IN4O4 — CID 111044711
tert-butyl N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111044711) has the molecular formula C17H29IN4O4 and a molecular weight of 480.35 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111044711 |
| Molecular Formula | C17H29IN4O4 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | tert-butyl N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCCNC(=O)OC(C)(C)C)cc1OC.I |
| InChI | InChI=1S/C17H28N4O4.HI/c1-17(2,3)25-16(22)20-10-6-9-19-15(18)21-12-7-8-13(23-4)14(11-12)24-5;/h7-8,11H,6,9-10H2,1-5H3,(H,20,22)(H3,18,19,21);1H |
| InChIKey | FDMNXTGOVVWOBR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|