C15H23ClIN3O3 — CID 111804941
tert-butyl 3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]propanoate;hydroiodide (PubChem CID 111804941) has the molecular formula C15H23ClIN3O3 and a molecular weight of 455.72 g/mol. Its IUPAC name is tert-butyl 3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]propanoate;hydroiodide.
| Compound Name | tert-butyl 3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111804941 |
| Molecular Formula | C15H23ClIN3O3 |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | tert-butyl 3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]propanoate;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCC(=O)OC(C)(C)C)cc1Cl.I |
| InChI | InChI=1S/C15H22ClN3O3.HI/c1-15(2,3)22-13(20)7-8-18-14(17)19-10-5-6-12(21-4)11(16)9-10;/h5-6,9H,7-8H2,1-4H3,(H3,17,18,19);1H |
| InChIKey | JUASBSJLZWHSOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|