C18H29ClN4O3 — CID 111808804
tert-butyl N-[3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate (PubChem CID 111808804) has the molecular formula C18H29ClN4O3 and a molecular weight of 384.91 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111808804 |
| Molecular Formula | C18H29ClN4O3 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | tert-butyl N-[3-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate |
| SMILES | COc1ccc(N/C(N)=N/CC(C)CN(C)C(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C18H29ClN4O3/c1-12(11-23(5)17(24)26-18(2,3)4)10-21-16(20)22-13-7-8-15(25-6)14(19)9-13/h7-9,12H,10-11H2,1-6H3,(H3,20,21,22) |
| InChIKey | BLKSALHVEAVYIP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|