C16H23ClN2O4 — CID 164573575
tert-butyl N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-ethylcarbamate (PubChem CID 164573575) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is tert-butyl N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 164573575 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | tert-butyl N-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-ethylcarbamate |
| SMILES | CCN(CC(=O)Nc1ccc(OC)c(Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23ClN2O4/c1-6-19(15(21)23-16(2,3)4)10-14(20)18-11-7-8-13(22-5)12(17)9-11/h7-9H,6,10H2,1-5H3,(H,18,20) |
| InChIKey | NRTIAAGYQNQHPY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |