C18H29ClN2O2 — CID 19855901
N-(3-chloro-4-methoxyphenyl)-2-[ethyl(heptyl)amino]acetamide (PubChem CID 19855901) has the molecular formula C18H29ClN2O2 and a molecular weight of 340.90 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[ethyl(heptyl)amino]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[ethyl(heptyl)amino]acetamide |
|---|---|
| PubChem CID | 19855901 |
| Molecular Formula | C18H29ClN2O2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[ethyl(heptyl)amino]acetamide |
| SMILES | CCCCCCCN(CC)CC(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C18H29ClN2O2/c1-4-6-7-8-9-12-21(5-2)14-18(22)20-15-10-11-17(23-3)16(19)13-15/h10-11,13H,4-9,12,14H2,1-3H3,(H,20,22) |
| InChIKey | NIJHPWXCCWBNPT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|