C18H31ClN2O — CID 19855895
N-(3-chloro-4-methoxyphenyl)-N'-ethyl-N'-heptylethane-1,2-diamine (PubChem CID 19855895) has the molecular formula C18H31ClN2O and a molecular weight of 326.91 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-ethyl-N'-heptylethane-1,2-diamine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-ethyl-N'-heptylethane-1,2-diamine |
|---|---|
| PubChem CID | 19855895 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-ethyl-N'-heptylethane-1,2-diamine |
| SMILES | CCCCCCCN(CC)CCNc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C18H31ClN2O/c1-4-6-7-8-9-13-21(5-2)14-12-20-16-10-11-18(22-3)17(19)15-16/h10-11,15,20H,4-9,12-14H2,1-3H3 |
| InChIKey | NZFKFGNGOHRTJF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|