C29H45Cl2N3O4S — CID 19855934
4-(butylsulfonylamino)-N-(3-chloro-4-methoxyphenyl)-N-[2-[ethyl(heptyl)amino]ethyl]benzamide;hydrochloride (PubChem CID 19855934) has the molecular formula C29H45Cl2N3O4S and a molecular weight of 602.67 g/mol. Its IUPAC name is 4-(butylsulfonylamino)-N-(3-chloro-4-methoxyphenyl)-N-[2-[ethyl(heptyl)amino]ethyl]benzamide;hydrochloride.
| Compound Name | 4-(butylsulfonylamino)-N-(3-chloro-4-methoxyphenyl)-N-[2-[ethyl(heptyl)amino]ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 19855934 |
| Molecular Formula | C29H45Cl2N3O4S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 4-(butylsulfonylamino)-N-(3-chloro-4-methoxyphenyl)-N-[2-[ethyl(heptyl)amino]ethyl]benzamide;hydrochloride |
| SMILES | CCCCCCCN(CC)CCN(C(=O)c1ccc(NS(=O)(=O)CCCC)cc1)c1ccc(OC)c(Cl)c1.Cl |
| InChI | InChI=1S/C29H44ClN3O4S.ClH/c1-5-8-10-11-12-19-32(7-3)20-21-33(26-17-18-28(37-4)27(30)23-26)29(34)24-13-15-25(16-14-24)31-38(35,36)22-9-6-2;/h13-18,23,31H,5-12,19-22H2,1-4H3;1H |
| InChIKey | TUHJQTISCWVWIG-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|