C25H33N3O8S — CID 56682884
(E)-but-2-enedioic acid;N-[2-(diethylamino)ethyl]-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzamide (PubChem CID 56682884) has the molecular formula C25H33N3O8S and a molecular weight of 535.62 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[2-(diethylamino)ethyl]-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzamide.
| Compound Name | (E)-but-2-enedioic acid;N-[2-(diethylamino)ethyl]-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 56682884 |
| Molecular Formula | C25H33N3O8S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[2-(diethylamino)ethyl]-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc(NS(C)(=O)=O)cc1)c1ccc(OC)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H29N3O4S.C4H4O4/c1-5-23(6-2)15-16-24(19-11-13-20(28-3)14-12-19)21(25)17-7-9-18(10-8-17)22-29(4,26)27;5-3(6)1-2-4(7)8/h7-14,22H,5-6,15-16H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YIYJUYJQECQFGU-WLHGVMLRSA-N |
| XLogP | 2.77 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|