C32H43N3O6S — CID 19855912
N-(4-butoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(methanesulfonamido)benzamide (PubChem CID 19855912) has the molecular formula C32H43N3O6S and a molecular weight of 597.78 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-(4-butoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 19855912 |
| Molecular Formula | C32H43N3O6S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | N-(4-butoxyphenyl)-N-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-4-(methanesulfonamido)benzamide |
| SMILES | CCCCOc1ccc(N(CCCN(C)CCc2ccc(OC)c(OC)c2)C(=O)c2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C32H43N3O6S/c1-6-7-23-41-29-16-14-28(15-17-29)35(32(36)26-10-12-27(13-11-26)33-42(5,37)38)21-8-20-34(2)22-19-25-9-18-30(39-3)31(24-25)40-4/h9-18,24,33H,6-8,19-23H2,1-5H3 |
| InChIKey | QEAAHIWCCHVILT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|