C24H26N2O5S — CID 38009998
4-(benzenesulfonamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide (PubChem CID 38009998) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 38009998 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbenzamide |
| SMILES | COc1ccc(CCN(C)C(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H26N2O5S/c1-26(16-15-18-9-14-22(30-2)23(17-18)31-3)24(27)19-10-12-20(13-11-19)25-32(28,29)21-7-5-4-6-8-21/h4-14,17,25H,15-16H2,1-3H3 |
| InChIKey | SEJOZMYOKLWICV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |