C21H21N3O7S2 — CID 90786253
N-[4-(benzenesulfonamidocarbamoyl)phenyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 90786253) has the molecular formula C21H21N3O7S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[4-(benzenesulfonamidocarbamoyl)phenyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-(benzenesulfonamidocarbamoyl)phenyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90786253 |
| Molecular Formula | C21H21N3O7S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[4-(benzenesulfonamidocarbamoyl)phenyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C(=O)NNS(=O)(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C21H21N3O7S2/c1-30-19-13-12-18(14-20(19)31-2)32(26,27)23-16-10-8-15(9-11-16)21(25)22-24-33(28,29)17-6-4-3-5-7-17/h3-14,23-24H,1-2H3,(H,22,25) |
| InChIKey | WTCWQOKXHNHXQU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|