C20H16F3N3O5S2 — CID 10311292
N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 10311292) has the molecular formula C20H16F3N3O5S2 and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10311292 |
| Molecular Formula | C20H16F3N3O5S2 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(NNS(=O)(=O)c1ccccc1)c1ccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H16F3N3O5S2/c21-20(22,23)15-8-12-18(13-9-15)32(28,29)25-16-10-6-14(7-11-16)19(27)24-26-33(30,31)17-4-2-1-3-5-17/h1-13,25-26H,(H,24,27) |
| InChIKey | XINORQLYGQERAV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|