C15H11F3N2O5S — CID 155949885
4-[[[4-(trifluoromethyl)benzoyl]amino]sulfamoyl]benzoic acid (PubChem CID 155949885) has the molecular formula C15H11F3N2O5S and a molecular weight of 388.32 g/mol. Its IUPAC name is 4-[[[4-(trifluoromethyl)benzoyl]amino]sulfamoyl]benzoic acid.
| Compound Name | 4-[[[4-(trifluoromethyl)benzoyl]amino]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155949885 |
| Molecular Formula | C15H11F3N2O5S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-[[[4-(trifluoromethyl)benzoyl]amino]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NNC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H11F3N2O5S/c16-15(17,18)11-5-1-9(2-6-11)13(21)19-20-26(24,25)12-7-3-10(4-8-12)14(22)23/h1-8,20H,(H,19,21)(H,22,23) |
| InChIKey | ABBLXOSWLFINAP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|