C14H10ClF3N2O3S — CID 8500429
4-chloro-N'-[3-(trifluoromethyl)phenyl]sulfonylbenzohydrazide (PubChem CID 8500429) has the molecular formula C14H10ClF3N2O3S and a molecular weight of 378.76 g/mol. Its IUPAC name is 4-chloro-N'-[3-(trifluoromethyl)phenyl]sulfonylbenzohydrazide.
| Compound Name | 4-chloro-N'-[3-(trifluoromethyl)phenyl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8500429 |
| Molecular Formula | C14H10ClF3N2O3S |
| Molecular Weight | 378.76 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 4-chloro-N'-[3-(trifluoromethyl)phenyl]sulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10ClF3N2O3S/c15-11-6-4-9(5-7-11)13(21)19-20-24(22,23)12-3-1-2-10(8-12)14(16,17)18/h1-8,20H,(H,19,21) |
| InChIKey | JAQQQFMKNAPBOV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|