C12H9F3N2O4S — CID 8616858
N'-[3-(trifluoromethyl)phenyl]sulfonylfuran-2-carbohydrazide (PubChem CID 8616858) has the molecular formula C12H9F3N2O4S and a molecular weight of 334.28 g/mol. Its IUPAC name is N'-[3-(trifluoromethyl)phenyl]sulfonylfuran-2-carbohydrazide.
| Compound Name | N'-[3-(trifluoromethyl)phenyl]sulfonylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 8616858 |
| Molecular Formula | C12H9F3N2O4S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | N'-[3-(trifluoromethyl)phenyl]sulfonylfuran-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccco1 |
| InChI | InChI=1S/C12H9F3N2O4S/c13-12(14,15)8-3-1-4-9(7-8)22(19,20)17-16-11(18)10-5-2-6-21-10/h1-7,17H,(H,16,18) |
| InChIKey | WMWWHYNUIHWHSZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|