C11H9N3O7S — CID 43001007
N'-(4-hydroxy-3-nitrophenyl)sulfonylfuran-2-carbohydrazide (PubChem CID 43001007) has the molecular formula C11H9N3O7S and a molecular weight of 327.27 g/mol. Its IUPAC name is N'-(4-hydroxy-3-nitrophenyl)sulfonylfuran-2-carbohydrazide.
| Compound Name | N'-(4-hydroxy-3-nitrophenyl)sulfonylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 43001007 |
| Molecular Formula | C11H9N3O7S |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | N'-(4-hydroxy-3-nitrophenyl)sulfonylfuran-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1)c1ccco1 |
| InChI | InChI=1S/C11H9N3O7S/c15-9-4-3-7(6-8(9)14(17)18)22(19,20)13-12-11(16)10-2-1-5-21-10/h1-6,13,15H,(H,12,16) |
| InChIKey | NCCNIXVNGJLEIW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|