C12H11N3O6S — CID 8616963
N'-(4-methyl-3-nitrophenyl)sulfonylfuran-2-carbohydrazide (PubChem CID 8616963) has the molecular formula C12H11N3O6S and a molecular weight of 325.30 g/mol. Its IUPAC name is N'-(4-methyl-3-nitrophenyl)sulfonylfuran-2-carbohydrazide.
| Compound Name | N'-(4-methyl-3-nitrophenyl)sulfonylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 8616963 |
| Molecular Formula | C12H11N3O6S |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N'-(4-methyl-3-nitrophenyl)sulfonylfuran-2-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)c2ccco2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O6S/c1-8-4-5-9(7-10(8)15(17)18)22(19,20)14-13-12(16)11-3-2-6-21-11/h2-7,14H,1H3,(H,13,16) |
| InChIKey | XNNNTJQIZVOBDL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|