C17H19N3O8S — CID 26680885
3,4,5-trimethoxy-N'-(4-methyl-3-nitrophenyl)sulfonylbenzohydrazide (PubChem CID 26680885) has the molecular formula C17H19N3O8S and a molecular weight of 425.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-(4-methyl-3-nitrophenyl)sulfonylbenzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-(4-methyl-3-nitrophenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 26680885 |
| Molecular Formula | C17H19N3O8S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 3,4,5-trimethoxy-N'-(4-methyl-3-nitrophenyl)sulfonylbenzohydrazide |
| SMILES | COc1cc(C(=O)NNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19N3O8S/c1-10-5-6-12(9-13(10)20(22)23)29(24,25)19-18-17(21)11-7-14(26-2)16(28-4)15(8-11)27-3/h5-9,19H,1-4H3,(H,18,21) |
| InChIKey | FXZXLLAFEAWYJJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|