C17H16FN3O6S — CID 9208056
(E)-3-(3-fluoro-4-methoxyphenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide (PubChem CID 9208056) has the molecular formula C17H16FN3O6S and a molecular weight of 409.40 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide |
|---|---|
| PubChem CID | 9208056 |
| Molecular Formula | C17H16FN3O6S |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide |
| SMILES | COc1ccc(/C=C/C(=O)NNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C17H16FN3O6S/c1-11-3-6-13(10-15(11)21(23)24)28(25,26)20-19-17(22)8-5-12-4-7-16(27-2)14(18)9-12/h3-10,20H,1-2H3,(H,19,22)/b8-5+ |
| InChIKey | SRMWXFKZKRNUIP-VMPITWQZSA-N |
| XLogP | 2.07 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|