C19H19NO6 — CID 51170420
(E)-3-(4-methyl-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 51170420) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is (E)-3-(4-methyl-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-methyl-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51170420 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (E)-3-(4-methyl-3-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccc(C)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO6/c1-12-5-6-13(9-15(12)20(22)23)7-8-16(21)14-10-17(24-2)19(26-4)18(11-14)25-3/h5-11H,1-4H3/b8-7+ |
| InChIKey | WYFPSBLSDPVYTM-BQYQJAHWSA-N |
| XLogP | 3.83 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|