C17H14N2O5 — CID 8860351
(E)-1,3-bis(4-methyl-3-nitrophenyl)prop-2-en-1-one (PubChem CID 8860351) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is (E)-1,3-bis(4-methyl-3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1,3-bis(4-methyl-3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8860351 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (E)-1,3-bis(4-methyl-3-nitrophenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N2O5/c1-11-3-5-13(9-15(11)18(21)22)6-8-17(20)14-7-4-12(2)16(10-14)19(23)24/h3-10H,1-2H3/b8-6+ |
| InChIKey | WBAFIIRJOHIGTC-SOFGYWHQSA-N |
| XLogP | 4.02 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|