C16H8F5NO3 — CID 3977798
1-(4-methyl-3-nitrophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 3977798) has the molecular formula C16H8F5NO3 and a molecular weight of 357.23 g/mol. Its IUPAC name is 1-(4-methyl-3-nitrophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | 1-(4-methyl-3-nitrophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3977798 |
| Molecular Formula | C16H8F5NO3 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-(4-methyl-3-nitrophenyl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C=Cc2c(F)c(F)c(F)c(F)c2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H8F5NO3/c1-7-2-3-8(6-10(7)22(24)25)11(23)5-4-9-12(17)14(19)16(21)15(20)13(9)18/h2-6H,1H3 |
| InChIKey | NNZPQOHHFSBSFL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|