C16H14FN3O5S — CID 9164920
(E)-3-(4-fluorophenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide (PubChem CID 9164920) has the molecular formula C16H14FN3O5S and a molecular weight of 379.37 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide.
| Compound Name | (E)-3-(4-fluorophenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide |
|---|---|
| PubChem CID | 9164920 |
| Molecular Formula | C16H14FN3O5S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N'-(4-methyl-3-nitrophenyl)sulfonylprop-2-enehydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)/C=C/c2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14FN3O5S/c1-11-2-8-14(10-15(11)20(22)23)26(24,25)19-18-16(21)9-5-12-3-6-13(17)7-4-12/h2-10,19H,1H3,(H,18,21)/b9-5+ |
| InChIKey | QQYFLBGEOROASN-WEVVVXLNSA-N |
| XLogP | 2.07 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|