C18H19FN2O5S — CID 9270537
(E)-N'-(4-ethoxyphenyl)sulfonyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enehydrazide (PubChem CID 9270537) has the molecular formula C18H19FN2O5S and a molecular weight of 394.42 g/mol. Its IUPAC name is (E)-N'-(4-ethoxyphenyl)sulfonyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-(4-ethoxyphenyl)sulfonyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9270537 |
| Molecular Formula | C18H19FN2O5S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (E)-N'-(4-ethoxyphenyl)sulfonyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enehydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)/C=C/c2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C18H19FN2O5S/c1-3-26-14-6-8-15(9-7-14)27(23,24)21-20-18(22)11-5-13-4-10-17(25-2)16(19)12-13/h4-12,21H,3H2,1-2H3,(H,20,22)/b11-5+ |
| InChIKey | LKNWUSUCXOBXNL-VZUCSPMQSA-N |
| XLogP | 2.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|