C19H24N2O6S — CID 9243942
3-(3,4-dimethoxyphenyl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide (PubChem CID 9243942) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 9243942 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N'-(4-ethoxyphenyl)sulfonylpropanehydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H24N2O6S/c1-4-27-15-7-9-16(10-8-15)28(23,24)21-20-19(22)12-6-14-5-11-17(25-2)18(13-14)26-3/h5,7-11,13,21H,4,6,12H2,1-3H3,(H,20,22) |
| InChIKey | XXUWEZWPUSXLCW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|