C18H21NO6S — CID 4143684
4-[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]benzenesulfonic acid (PubChem CID 4143684) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]benzenesulfonic acid.
| Compound Name | 4-[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 4143684 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]benzenesulfonic acid |
| SMILES | CCOc1ccc(CCC(=O)Nc2ccc(S(=O)(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C18H21NO6S/c1-3-25-16-10-4-13(12-17(16)24-2)5-11-18(20)19-14-6-8-15(9-7-14)26(21,22)23/h4,6-10,12H,3,5,11H2,1-2H3,(H,19,20)(H,21,22,23) |
| InChIKey | XRHPLKOMUASBRW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|