C25H26Cl2N2O5S — CID 43885129
N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-diethoxyphenyl)propanamide (PubChem CID 43885129) has the molecular formula C25H26Cl2N2O5S and a molecular weight of 537.47 g/mol. Its IUPAC name is N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-diethoxyphenyl)propanamide.
| Compound Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-diethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 43885129 |
| Molecular Formula | C25H26Cl2N2O5S |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(3,4-diethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)Nc2ccc(S(=O)(=O)Nc3cc(Cl)cc(Cl)c3)cc2)cc1OCC |
| InChI | InChI=1S/C25H26Cl2N2O5S/c1-3-33-23-11-5-17(13-24(23)34-4-2)6-12-25(30)28-20-7-9-22(10-8-20)35(31,32)29-21-15-18(26)14-19(27)16-21/h5,7-11,13-16,29H,3-4,6,12H2,1-2H3,(H,28,30) |
| InChIKey | FFRRSJCIXTXNOM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |