C21H26ClNO3 — CID 16574764
3-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]propanamide (PubChem CID 16574764) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 16574764 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]propanamide |
| SMILES | CCOc1ccc(CCNC(=O)CCc2ccc(Cl)cc2)cc1OCC |
| InChI | InChI=1S/C21H26ClNO3/c1-3-25-19-11-7-17(15-20(19)26-4-2)13-14-23-21(24)12-8-16-5-9-18(22)10-6-16/h5-7,9-11,15H,3-4,8,12-14H2,1-2H3,(H,23,24) |
| InChIKey | SMXWCIDOLHKICL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |