C20H24ClNO4 — CID 7818885
2-(3-chlorophenoxy)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide (PubChem CID 7818885) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 7818885 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)COc2cccc(Cl)c2)cc1OCC |
| InChI | InChI=1S/C20H24ClNO4/c1-3-24-18-9-8-15(12-19(18)25-4-2)10-11-22-20(23)14-26-17-7-5-6-16(21)13-17/h5-9,12-13H,3-4,10-11,14H2,1-2H3,(H,22,23) |
| InChIKey | DKSFUXDHOWXVEW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |