C26H29NO4 — CID 7919539
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-phenylphenoxy)acetamide (PubChem CID 7919539) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 7919539 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-phenylphenoxy)acetamide |
| SMILES | CCOc1ccc(CCNC(=O)COc2ccc(-c3ccccc3)cc2)cc1OCC |
| InChI | InChI=1S/C26H29NO4/c1-3-29-24-15-10-20(18-25(24)30-4-2)16-17-27-26(28)19-31-23-13-11-22(12-14-23)21-8-6-5-7-9-21/h5-15,18H,3-4,16-17,19H2,1-2H3,(H,27,28) |
| InChIKey | GZLIFTBSABWKBI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |