C24H29N3O4 — CID 20918168
N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 20918168) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 20918168 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)NCCc3ccc(OCC)c(OCC)c3)[nH]n2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-4-29-19-10-8-18(9-11-19)20-16-21(27-26-20)24(28)25-14-13-17-7-12-22(30-5-2)23(15-17)31-6-3/h7-12,15-16H,4-6,13-14H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | ADPGMHBBDVSKDG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |