C21H24F3NO4 — CID 9473964
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 9473964) has the molecular formula C21H24F3NO4 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 9473964 |
| Molecular Formula | C21H24F3NO4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)COc2cccc(C(F)(F)F)c2)cc1OCC |
| InChI | InChI=1S/C21H24F3NO4/c1-3-27-18-9-8-15(12-19(18)28-4-2)10-11-25-20(26)14-29-17-7-5-6-16(13-17)21(22,23)24/h5-9,12-13H,3-4,10-11,14H2,1-2H3,(H,25,26) |
| InChIKey | CWHCASJJKXRBSP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |