C21H23F3N2O4 — CID 108529772
N-[2-(3,4-diethoxyphenyl)ethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 108529772) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108529772 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)Nc2ccc(C(F)(F)F)cc2)cc1OCC |
| InChI | InChI=1S/C21H23F3N2O4/c1-3-29-17-10-5-14(13-18(17)30-4-2)11-12-25-19(27)20(28)26-16-8-6-15(7-9-16)21(22,23)24/h5-10,13H,3-4,11-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | AOVBKTCHHCDNPF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|