C21H23N3O4S — CID 108527792
[4-[[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108527792) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is [4-[[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108527792 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [4-[[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)Nc2ccc(SC#N)cc2)cc1OCC |
| InChI | InChI=1S/C21H23N3O4S/c1-3-27-18-10-5-15(13-19(18)28-4-2)11-12-23-20(25)21(26)24-16-6-8-17(9-7-16)29-14-22/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | AMFOESSDHKQSDL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|