C20H23FN2O4 — CID 108529747
N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(3-fluorophenyl)oxamide (PubChem CID 108529747) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(3-fluorophenyl)oxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 108529747 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(3-fluorophenyl)oxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)Nc2cccc(F)c2)cc1OCC |
| InChI | InChI=1S/C20H23FN2O4/c1-3-26-17-9-8-14(12-18(17)27-4-2)10-11-22-19(24)20(25)23-16-7-5-6-15(21)13-16/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YHTYOBSGSRWHKM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|