C16H14ClFN2O2 — CID 7292818
N-[2-(4-chlorophenyl)ethyl]-N'-(3-fluorophenyl)oxamide (PubChem CID 7292818) has the molecular formula C16H14ClFN2O2 and a molecular weight of 320.75 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-(3-fluorophenyl)oxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 7292818 |
| Molecular Formula | C16H14ClFN2O2 |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-(3-fluorophenyl)oxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H14ClFN2O2/c17-12-6-4-11(5-7-12)8-9-19-15(21)16(22)20-14-3-1-2-13(18)10-14/h1-7,10H,8-9H2,(H,19,21)(H,20,22) |
| InChIKey | VAROTRGXJGVYNF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|