C18H17ClN2O3 — CID 108985815
N'-(3-acetylphenyl)-N-[2-(4-chlorophenyl)ethyl]oxamide (PubChem CID 108985815) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-[2-(4-chlorophenyl)ethyl]oxamide.
| Compound Name | N'-(3-acetylphenyl)-N-[2-(4-chlorophenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108985815 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N'-(3-acetylphenyl)-N-[2-(4-chlorophenyl)ethyl]oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)NCCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-12(22)14-3-2-4-16(11-14)21-18(24)17(23)20-10-9-13-5-7-15(19)8-6-13/h2-8,11H,9-10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | JUGAOCKOKUGUSX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|