C18H16Cl2N2O3 — CID 108986646
N'-(3-acetylphenyl)-N-[2-(2,4-dichlorophenyl)ethyl]oxamide (PubChem CID 108986646) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-[2-(2,4-dichlorophenyl)ethyl]oxamide.
| Compound Name | N'-(3-acetylphenyl)-N-[2-(2,4-dichlorophenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108986646 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N'-(3-acetylphenyl)-N-[2-(2,4-dichlorophenyl)ethyl]oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-11(23)13-3-2-4-15(9-13)22-18(25)17(24)21-8-7-12-5-6-14(19)10-16(12)20/h2-6,9-10H,7-8H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | FTRAXYINYFMVHJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|