C17H17Cl2N3O2 — CID 108991040
N-[3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]phenyl]acetamide (PubChem CID 108991040) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 108991040 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-11(23)21-14-3-2-4-15(10-14)22-17(24)20-8-7-12-5-6-13(18)9-16(12)19/h2-6,9-10H,7-8H2,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | WDNPXJUSEPHOPN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |