C16H14Cl2N2O2 — CID 7914502
N-(3-acetamidophenyl)-2-(2,4-dichlorophenyl)acetamide (PubChem CID 7914502) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7914502 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(3-acetamidophenyl)-2-(2,4-dichlorophenyl)acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c1-10(21)19-13-3-2-4-14(9-13)20-16(22)7-11-5-6-12(17)8-15(11)18/h2-6,8-9H,7H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | TUZRDOPNIZOFRA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |