C15H12BrCl2NO — CID 7959233
N-(4-bromo-3-methylphenyl)-2-(2,4-dichlorophenyl)acetamide (PubChem CID 7959233) has the molecular formula C15H12BrCl2NO and a molecular weight of 373.08 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7959233 |
| Molecular Formula | C15H12BrCl2NO |
| Molecular Weight | 373.08 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(2,4-dichlorophenyl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2ccc(Cl)cc2Cl)ccc1Br |
| InChI | InChI=1S/C15H12BrCl2NO/c1-9-6-12(4-5-13(9)16)19-15(20)7-10-2-3-11(17)8-14(10)18/h2-6,8H,7H2,1H3,(H,19,20) |
| InChIKey | DCGLARFRDOJFOD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.08 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |