C15H11BrCl3NO — CID 100606713
N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)propanamide (PubChem CID 100606713) has the molecular formula C15H11BrCl3NO and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 100606713 |
| Molecular Formula | C15H11BrCl3NO |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-3-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H11BrCl3NO/c16-12-5-4-11(8-14(12)19)20-15(21)6-2-9-1-3-10(17)7-13(9)18/h1,3-5,7-8H,2,6H2,(H,20,21) |
| InChIKey | ZLPKXEURCVWMDT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |