C18H18Cl2N2O2 — CID 92851593
4-[3-(2,4-dichlorophenyl)propanoylamino]-N,N-dimethylbenzamide (PubChem CID 92851593) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 4-[3-(2,4-dichlorophenyl)propanoylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(2,4-dichlorophenyl)propanoylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 92851593 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-[3-(2,4-dichlorophenyl)propanoylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-22(2)18(24)13-4-8-15(9-5-13)21-17(23)10-6-12-3-7-14(19)11-16(12)20/h3-5,7-9,11H,6,10H2,1-2H3,(H,21,23) |
| InChIKey | MHLRDLTWECQTBE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |