C19H15Cl2NO — CID 100605346
3-(2,4-dichlorophenyl)-N-naphthalen-2-ylpropanamide (PubChem CID 100605346) has the molecular formula C19H15Cl2NO and a molecular weight of 344.24 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-naphthalen-2-ylpropanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 100605346 |
| Molecular Formula | C19H15Cl2NO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-naphthalen-2-ylpropanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15Cl2NO/c20-16-8-5-14(18(21)12-16)7-10-19(23)22-17-9-6-13-3-1-2-4-15(13)11-17/h1-6,8-9,11-12H,7,10H2,(H,22,23) |
| InChIKey | FSSAQBUGCFEVOW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |