C18H13Cl2NO — CID 7900527
2-(3,4-dichlorophenyl)-N-naphthalen-2-ylacetamide (PubChem CID 7900527) has the molecular formula C18H13Cl2NO and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-naphthalen-2-ylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 7900527 |
| Molecular Formula | C18H13Cl2NO |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H13Cl2NO/c19-16-8-5-12(9-17(16)20)10-18(22)21-15-7-6-13-3-1-2-4-14(13)11-15/h1-9,11H,10H2,(H,21,22) |
| InChIKey | OERWHVCNYLVHNG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |