C19H17NO — CID 9411639
N-(4-methylphenyl)-2-naphthalen-2-ylacetamide (PubChem CID 9411639) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(4-methylphenyl)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 9411639 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(4-methylphenyl)-2-naphthalen-2-ylacetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C19H17NO/c1-14-6-10-18(11-7-14)20-19(21)13-15-8-9-16-4-2-3-5-17(16)12-15/h2-12H,13H2,1H3,(H,20,21) |
| InChIKey | DVFBVEQHHLHZIX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |