C42H33N3O3 — CID 67257199
N-[3,5-bis[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-naphthalen-2-ylacetamide (PubChem CID 67257199) has the molecular formula C42H33N3O3 and a molecular weight of 627.74 g/mol. Its IUPAC name is N-[3,5-bis[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[3,5-bis[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 67257199 |
| Molecular Formula | C42H33N3O3 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | N-[3,5-bis[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1cc(NC(=O)Cc2ccc3ccccc3c2)cc(NC(=O)Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C42H33N3O3/c46-40(22-28-13-16-31-7-1-4-10-34(31)19-28)43-37-25-38(44-41(47)23-29-14-17-32-8-2-5-11-35(32)20-29)27-39(26-37)45-42(48)24-30-15-18-33-9-3-6-12-36(33)21-30/h1-21,25-27H,22-24H2,(H,43,46)(H,44,47)(H,45,48) |
| InChIKey | PADOXZJEDZVFJB-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |